C20H27N3O2 — CID 110795645
1-acetyl-N-[2-(1,2-dimethylindol-3-yl)ethyl]piperidine-4-carboxamide (PubChem CID 110795645) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 1-acetyl-N-[2-(1,2-dimethylindol-3-yl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-[2-(1,2-dimethylindol-3-yl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110795645 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 1-acetyl-N-[2-(1,2-dimethylindol-3-yl)ethyl]piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)NCCc2c(C)n(C)c3ccccc23)CC1 |
| InChI | InChI=1S/C20H27N3O2/c1-14-17(18-6-4-5-7-19(18)22(14)3)8-11-21-20(25)16-9-12-23(13-10-16)15(2)24/h4-7,16H,8-13H2,1-3H3,(H,21,25) |
| InChIKey | SDIQKQCEMAHJIM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|