C11H11Br2N5O — CID 11079644
2-(2,3-dibromo-9-oxo-1,5,6,7-tetrahydropyrrolo[2,3-f]indolizin-4-yl)guanidine (PubChem CID 11079644) has the molecular formula C11H11Br2N5O and a molecular weight of 389.05 g/mol. Its IUPAC name is 2-(2,3-dibromo-9-oxo-1,5,6,7-tetrahydropyrrolo[2,3-f]indolizin-4-yl)guanidine.
| Compound Name | 2-(2,3-dibromo-9-oxo-1,5,6,7-tetrahydropyrrolo[2,3-f]indolizin-4-yl)guanidine |
|---|---|
| PubChem CID | 11079644 |
| Molecular Formula | C11H11Br2N5O |
| Molecular Weight | 389.05 g/mol |
| Exact Mass | 386.93 |
| IUPAC Name | 2-(2,3-dibromo-9-oxo-1,5,6,7-tetrahydropyrrolo[2,3-f]indolizin-4-yl)guanidine |
| SMILES | NC(N)=Nc1c2n(c(=O)c3[nH]c(Br)c(Br)c13)CCC2 |
| InChI | InChI=1S/C11H11Br2N5O/c12-6-5-7(17-11(14)15)4-2-1-3-18(4)10(19)8(5)16-9(6)13/h16H,1-3H2,(H4,14,15,17) |
| InChIKey | WNFGJYRDKBZYOI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 102.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.05 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|