C14H20N2O2S — CID 110796443
1-[4-(2-thiophen-2-ylacetyl)-1,4-diazepan-1-yl]propan-1-one (PubChem CID 110796443) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 1-[4-(2-thiophen-2-ylacetyl)-1,4-diazepan-1-yl]propan-1-one.
| Compound Name | 1-[4-(2-thiophen-2-ylacetyl)-1,4-diazepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 110796443 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 1-[4-(2-thiophen-2-ylacetyl)-1,4-diazepan-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCCN(C(=O)Cc2cccs2)CC1 |
| InChI | InChI=1S/C14H20N2O2S/c1-2-13(17)15-6-4-7-16(9-8-15)14(18)11-12-5-3-10-19-12/h3,5,10H,2,4,6-9,11H2,1H3 |
| InChIKey | ABWWAHIALFNSHW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |