C18H24N2O4 — CID 110797625
methyl 4-[4-(4-methylbenzoyl)-1,4-diazepan-1-yl]-4-oxobutanoate (PubChem CID 110797625) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is methyl 4-[4-(4-methylbenzoyl)-1,4-diazepan-1-yl]-4-oxobutanoate.
| Compound Name | methyl 4-[4-(4-methylbenzoyl)-1,4-diazepan-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 110797625 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | methyl 4-[4-(4-methylbenzoyl)-1,4-diazepan-1-yl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N1CCCN(C(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C18H24N2O4/c1-14-4-6-15(7-5-14)18(23)20-11-3-10-19(12-13-20)16(21)8-9-17(22)24-2/h4-7H,3,8-13H2,1-2H3 |
| InChIKey | WVMPWNRKVMDHKY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |