C19H23F3N4O2 — CID 11079800
7-butyl-7-ethyl-3-[2-(trifluoromethyl)phenyl]-4,9-dihydro-2H-pyrimido[1,2-a][1,3,5]triazine-6,8-dione (PubChem CID 11079800) has the molecular formula C19H23F3N4O2 and a molecular weight of 396.41 g/mol. Its IUPAC name is 7-butyl-7-ethyl-3-[2-(trifluoromethyl)phenyl]-4,9-dihydro-2H-pyrimido[1,2-a][1,3,5]triazine-6,8-dione.
| Compound Name | 7-butyl-7-ethyl-3-[2-(trifluoromethyl)phenyl]-4,9-dihydro-2H-pyrimido[1,2-a][1,3,5]triazine-6,8-dione |
|---|---|
| PubChem CID | 11079800 |
| Molecular Formula | C19H23F3N4O2 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 7-butyl-7-ethyl-3-[2-(trifluoromethyl)phenyl]-4,9-dihydro-2H-pyrimido[1,2-a][1,3,5]triazine-6,8-dione |
| SMILES | CCCCC1(CC)C(=O)NC2=NCN(c3ccccc3C(F)(F)F)CN2C1=O |
| InChI | InChI=1S/C19H23F3N4O2/c1-3-5-10-18(4-2)15(27)24-17-23-11-25(12-26(17)16(18)28)14-9-7-6-8-13(14)19(20,21)22/h6-9H,3-5,10-12H2,1-2H3,(H,23,24,27) |
| InChIKey | JCUFPPCQOQQTIF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|