C15H22N2O3S — CID 110798192
phenyl-(4-propylsulfonyl-1,4-diazepan-1-yl)methanone (PubChem CID 110798192) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is phenyl-(4-propylsulfonyl-1,4-diazepan-1-yl)methanone.
| Compound Name | phenyl-(4-propylsulfonyl-1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 110798192 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | phenyl-(4-propylsulfonyl-1,4-diazepan-1-yl)methanone |
| SMILES | CCCS(=O)(=O)N1CCCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C15H22N2O3S/c1-2-13-21(19,20)17-10-6-9-16(11-12-17)15(18)14-7-4-3-5-8-14/h3-5,7-8H,2,6,9-13H2,1H3 |
| InChIKey | PGCCTWPEUXLQOZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |