C21H24N2O3 — CID 110798222
1-[4-(2-methylbenzoyl)-1,4-diazepan-1-yl]-2-phenoxyethanone (PubChem CID 110798222) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 1-[4-(2-methylbenzoyl)-1,4-diazepan-1-yl]-2-phenoxyethanone.
| Compound Name | 1-[4-(2-methylbenzoyl)-1,4-diazepan-1-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 110798222 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 1-[4-(2-methylbenzoyl)-1,4-diazepan-1-yl]-2-phenoxyethanone |
| SMILES | Cc1ccccc1C(=O)N1CCCN(C(=O)COc2ccccc2)CC1 |
| InChI | InChI=1S/C21H24N2O3/c1-17-8-5-6-11-19(17)21(25)23-13-7-12-22(14-15-23)20(24)16-26-18-9-3-2-4-10-18/h2-6,8-11H,7,12-16H2,1H3 |
| InChIKey | AJVJEGJPPMLTNF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |