C21H20FN3O2 — CID 110798451
3-[4-[2-(3-fluorophenyl)acetyl]-1,4-diazepane-1-carbonyl]benzonitrile (PubChem CID 110798451) has the molecular formula C21H20FN3O2 and a molecular weight of 365.41 g/mol. Its IUPAC name is 3-[4-[2-(3-fluorophenyl)acetyl]-1,4-diazepane-1-carbonyl]benzonitrile.
| Compound Name | 3-[4-[2-(3-fluorophenyl)acetyl]-1,4-diazepane-1-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 110798451 |
| Molecular Formula | C21H20FN3O2 |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 3-[4-[2-(3-fluorophenyl)acetyl]-1,4-diazepane-1-carbonyl]benzonitrile |
| SMILES | N#Cc1cccc(C(=O)N2CCCN(C(=O)Cc3cccc(F)c3)CC2)c1 |
| InChI | InChI=1S/C21H20FN3O2/c22-19-7-2-4-16(13-19)14-20(26)24-8-3-9-25(11-10-24)21(27)18-6-1-5-17(12-18)15-23/h1-2,4-7,12-13H,3,8-11,14H2 |
| InChIKey | UCJVOFXFFBHOPV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |