C19H28N2O3 — CID 110798584
ethyl 4-(4-tert-butylbenzoyl)-1,4-diazepane-1-carboxylate (PubChem CID 110798584) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is ethyl 4-(4-tert-butylbenzoyl)-1,4-diazepane-1-carboxylate.
| Compound Name | ethyl 4-(4-tert-butylbenzoyl)-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 110798584 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | ethyl 4-(4-tert-butylbenzoyl)-1,4-diazepane-1-carboxylate |
| SMILES | CCOC(=O)N1CCCN(C(=O)c2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C19H28N2O3/c1-5-24-18(23)21-12-6-11-20(13-14-21)17(22)15-7-9-16(10-8-15)19(2,3)4/h7-10H,5-6,11-14H2,1-4H3 |
| InChIKey | ZKYMMUGNNQSDMQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |