C24H34O3Si — CID 11079860
(8S,9S,10R,11S,13S,14S)-17-acetyl-10,13-dimethyl-11-trimethylsilyloxy-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 11079860) has the molecular formula C24H34O3Si and a molecular weight of 398.62 g/mol. Its IUPAC name is (8S,9S,10R,11S,13S,14S)-17-acetyl-10,13-dimethyl-11-trimethylsilyloxy-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,11S,13S,14S)-17-acetyl-10,13-dimethyl-11-trimethylsilyloxy-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 11079860 |
| Molecular Formula | C24H34O3Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | (8S,9S,10R,11S,13S,14S)-17-acetyl-10,13-dimethyl-11-trimethylsilyloxy-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)C1=CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C)C[C@]12C |
| InChI | InChI=1S/C24H34O3Si/c1-15(25)19-9-10-20-18-8-7-16-13-17(26)11-12-23(16,2)22(18)21(14-24(19,20)3)27-28(4,5)6/h9,11-13,18,20-22H,7-8,10,14H2,1-6H3/t18-,20-,21-,22+,23-,24+/m0/s1 |
| InChIKey | FNYFDLAWPLCUJO-OLZNRLLJSA-N |
| XLogP | 5.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|