C12H26N2O4S2 — CID 110799667
1-butylsulfonyl-4-propylsulfonyl-1,4-diazepane (PubChem CID 110799667) has the molecular formula C12H26N2O4S2 and a molecular weight of 326.48 g/mol. Its IUPAC name is 1-butylsulfonyl-4-propylsulfonyl-1,4-diazepane.
| Compound Name | 1-butylsulfonyl-4-propylsulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 110799667 |
| Molecular Formula | C12H26N2O4S2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 1-butylsulfonyl-4-propylsulfonyl-1,4-diazepane |
| SMILES | CCCCS(=O)(=O)N1CCCN(S(=O)(=O)CCC)CC1 |
| InChI | InChI=1S/C12H26N2O4S2/c1-3-5-12-20(17,18)14-8-6-7-13(9-10-14)19(15,16)11-4-2/h3-12H2,1-2H3 |
| InChIKey | WWOGNTFMXYBKNM-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |