C12H21N3O2S — CID 110799962
1-[4-(1,3-thiazolidine-4-carbonyl)piperazin-1-yl]butan-1-one (PubChem CID 110799962) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is 1-[4-(1,3-thiazolidine-4-carbonyl)piperazin-1-yl]butan-1-one.
| Compound Name | 1-[4-(1,3-thiazolidine-4-carbonyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 110799962 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 1-[4-(1,3-thiazolidine-4-carbonyl)piperazin-1-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCN(C(=O)C2CSCN2)CC1 |
| InChI | InChI=1S/C12H21N3O2S/c1-2-3-11(16)14-4-6-15(7-5-14)12(17)10-8-18-9-13-10/h10,13H,2-9H2,1H3 |
| InChIKey | VMLHGYXSOMZWIX-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |