C20H26N4O2 — CID 110801719
1-[4-(cyclopentanecarbonyl)piperazin-1-yl]-2-(1-methylbenzimidazol-5-yl)ethanone (PubChem CID 110801719) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-[4-(cyclopentanecarbonyl)piperazin-1-yl]-2-(1-methylbenzimidazol-5-yl)ethanone.
| Compound Name | 1-[4-(cyclopentanecarbonyl)piperazin-1-yl]-2-(1-methylbenzimidazol-5-yl)ethanone |
|---|---|
| PubChem CID | 110801719 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 1-[4-(cyclopentanecarbonyl)piperazin-1-yl]-2-(1-methylbenzimidazol-5-yl)ethanone |
| SMILES | Cn1cnc2cc(CC(=O)N3CCN(C(=O)C4CCCC4)CC3)ccc21 |
| InChI | InChI=1S/C20H26N4O2/c1-22-14-21-17-12-15(6-7-18(17)22)13-19(25)23-8-10-24(11-9-23)20(26)16-4-2-3-5-16/h6-7,12,14,16H,2-5,8-11,13H2,1H3 |
| InChIKey | IPKCJXRWWDSMML-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |