C22H48O3Si2 — CID 11080238
triethyl-[[(2R,3R)-2-methyl-3-[(2R,3R)-3-triethylsilyloxyhexan-2-yl]oxiran-2-yl]methoxy]silane (PubChem CID 11080238) has the molecular formula C22H48O3Si2 and a molecular weight of 416.80 g/mol. Its IUPAC name is triethyl-[[(2R,3R)-2-methyl-3-[(2R,3R)-3-triethylsilyloxyhexan-2-yl]oxiran-2-yl]methoxy]silane.
| Compound Name | triethyl-[[(2R,3R)-2-methyl-3-[(2R,3R)-3-triethylsilyloxyhexan-2-yl]oxiran-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 11080238 |
| Molecular Formula | C22H48O3Si2 |
| Molecular Weight | 416.80 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | triethyl-[[(2R,3R)-2-methyl-3-[(2R,3R)-3-triethylsilyloxyhexan-2-yl]oxiran-2-yl]methoxy]silane |
| SMILES | CCC[C@@H](O[Si](CC)(CC)CC)[C@H](C)[C@H]1O[C@]1(C)CO[Si](CC)(CC)CC |
| InChI | InChI=1S/C22H48O3Si2/c1-10-17-20(25-27(14-5,15-6)16-7)19(8)21-22(9,24-21)18-23-26(11-2,12-3)13-4/h19-21H,10-18H2,1-9H3/t19-,20+,21+,22+/m0/s1 |
| InChIKey | OEORVMYQISOKGQ-DXBBTUNJSA-N |
| XLogP | 6.99 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.80 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|