C20H20F2N2O3 — CID 110802400
1-[4-(4-fluorobenzoyl)piperazin-1-yl]-2-(3-fluoro-4-methoxyphenyl)ethanone (PubChem CID 110802400) has the molecular formula C20H20F2N2O3 and a molecular weight of 374.39 g/mol. Its IUPAC name is 1-[4-(4-fluorobenzoyl)piperazin-1-yl]-2-(3-fluoro-4-methoxyphenyl)ethanone.
| Compound Name | 1-[4-(4-fluorobenzoyl)piperazin-1-yl]-2-(3-fluoro-4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 110802400 |
| Molecular Formula | C20H20F2N2O3 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 1-[4-(4-fluorobenzoyl)piperazin-1-yl]-2-(3-fluoro-4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(CC(=O)N2CCN(C(=O)c3ccc(F)cc3)CC2)cc1F |
| InChI | InChI=1S/C20H20F2N2O3/c1-27-18-7-2-14(12-17(18)22)13-19(25)23-8-10-24(11-9-23)20(26)15-3-5-16(21)6-4-15/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | AHUOVRVDLISYJY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |