C23H29N2O3+ — CID 11080241
6,7-dimethoxy-2-[(2S)-2-(phenylmethoxymethyl)pyrrolidin-1-yl]-3,4-dihydroisoquinolin-2-ium (PubChem CID 11080241) has the molecular formula C23H29N2O3+ and a molecular weight of 381.50 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[(2S)-2-(phenylmethoxymethyl)pyrrolidin-1-yl]-3,4-dihydroisoquinolin-2-ium.
| Compound Name | 6,7-dimethoxy-2-[(2S)-2-(phenylmethoxymethyl)pyrrolidin-1-yl]-3,4-dihydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 11080241 |
| Molecular Formula | C23H29N2O3+ |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 6,7-dimethoxy-2-[(2S)-2-(phenylmethoxymethyl)pyrrolidin-1-yl]-3,4-dihydroisoquinolin-2-ium |
| SMILES | COc1cc2c(cc1OC)CC[N+](N1CCC[C@H]1COCc1ccccc1)=C2 |
| InChI | InChI=1S/C23H29N2O3/c1-26-22-13-19-10-12-24(15-20(19)14-23(22)27-2)25-11-6-9-21(25)17-28-16-18-7-4-3-5-8-18/h3-5,7-8,13-15,21H,6,9-12,16-17H2,1-2H3/q+1/t21-/m0/s1 |
| InChIKey | BKUFIMOBTDBFNW-NRFANRHFSA-N |
| XLogP | 3.29 |
| TPSA | 33.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|