C25H44O3Si — CID 11080314
(3S,5S,6S)-6-methyl-1-phenylmethoxy-5-tri(propan-2-yl)silyloxyoct-7-en-3-ol (PubChem CID 11080314) has the molecular formula C25H44O3Si and a molecular weight of 420.71 g/mol. Its IUPAC name is (3S,5S,6S)-6-methyl-1-phenylmethoxy-5-tri(propan-2-yl)silyloxyoct-7-en-3-ol.
| Compound Name | (3S,5S,6S)-6-methyl-1-phenylmethoxy-5-tri(propan-2-yl)silyloxyoct-7-en-3-ol |
|---|---|
| PubChem CID | 11080314 |
| Molecular Formula | C25H44O3Si |
| Molecular Weight | 420.71 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | (3S,5S,6S)-6-methyl-1-phenylmethoxy-5-tri(propan-2-yl)silyloxyoct-7-en-3-ol |
| SMILES | C=C[C@H](C)[C@H](C[C@@H](O)CCOCc1ccccc1)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H44O3Si/c1-9-22(8)25(28-29(19(2)3,20(4)5)21(6)7)17-24(26)15-16-27-18-23-13-11-10-12-14-23/h9-14,19-22,24-26H,1,15-18H2,2-8H3/t22-,24-,25-/m0/s1 |
| InChIKey | ATTXDBBMVWTIOL-HVCNVCAESA-N |
| XLogP | 6.73 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.71 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|