About tetraphenylboranuide;triethylazanium
tetraphenylboranuide;triethylazanium (PubChem CID 11080326) has the molecular formula C30H36BN
and a molecular weight of 421.44 g/mol. Its IUPAC name is tetraphenylboranuide;triethylazanium.
Molecular Properties
| Compound Name | tetraphenylboranuide;triethylazanium |
| PubChem CID | 11080326 |
| Molecular Formula | C30H36BN |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.29 |
| IUPAC Name | tetraphenylboranuide;triethylazanium |
| SMILES | CC[NH+](CC)CC.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C6H15N/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-4-7(5-2)6-3/h1-20H;4-6H2,1-3H3/q-1;/p+1 |
| InChIKey | XQSMJIJEESBUTH-UHFFFAOYSA-O |
| XLogP | 2.99 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tetraphenylboranuide;triethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetraphenylboranuide;triethylazanium?
The IUPAC name of tetraphenylboranuide;triethylazanium (CID 11080326) is tetraphenylboranuide;triethylazanium.
What is the SMILES notation for tetraphenylboranuide;triethylazanium?
The canonical SMILES for tetraphenylboranuide;triethylazanium is CC[NH+](CC)CC.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of tetraphenylboranuide;triethylazanium?
The InChIKey is XQSMJIJEESBUTH-UHFFFAOYSA-O. The full InChI is InChI=1S/C24H20B.C6H15N/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-4-7(5-2)6-3/h1-20H;4-6H2,1-3H3/q-1;/p+1.
What are the key properties of tetraphenylboranuide;triethylazanium?
tetraphenylboranuide;triethylazanium has a molecular weight of 421.44 g/mol, XLogP of 2.99, 7 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetraphenylboranuide;triethylazanium is sourced from PubChem (CID 11080326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).