C16H20N4O3 — CID 110803344
methyl 4-(2-ethyl-3H-benzimidazole-5-carbonyl)piperazine-1-carboxylate (PubChem CID 110803344) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is methyl 4-(2-ethyl-3H-benzimidazole-5-carbonyl)piperazine-1-carboxylate.
| Compound Name | methyl 4-(2-ethyl-3H-benzimidazole-5-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110803344 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | methyl 4-(2-ethyl-3H-benzimidazole-5-carbonyl)piperazine-1-carboxylate |
| SMILES | CCc1nc2ccc(C(=O)N3CCN(C(=O)OC)CC3)cc2[nH]1 |
| InChI | InChI=1S/C16H20N4O3/c1-3-14-17-12-5-4-11(10-13(12)18-14)15(21)19-6-8-20(9-7-19)16(22)23-2/h4-5,10H,3,6-9H2,1-2H3,(H,17,18) |
| InChIKey | XAGOMPFBJDODBP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |