C16H24N2O4S — CID 110804678
(4-ethoxy-3-methylphenyl)-(4-ethylsulfonylpiperazin-1-yl)methanone (PubChem CID 110804678) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is (4-ethoxy-3-methylphenyl)-(4-ethylsulfonylpiperazin-1-yl)methanone.
| Compound Name | (4-ethoxy-3-methylphenyl)-(4-ethylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 110804678 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (4-ethoxy-3-methylphenyl)-(4-ethylsulfonylpiperazin-1-yl)methanone |
| SMILES | CCOc1ccc(C(=O)N2CCN(S(=O)(=O)CC)CC2)cc1C |
| InChI | InChI=1S/C16H24N2O4S/c1-4-22-15-7-6-14(12-13(15)3)16(19)17-8-10-18(11-9-17)23(20,21)5-2/h6-7,12H,4-5,8-11H2,1-3H3 |
| InChIKey | GFRMEXUMNXWSAU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |