C12H17ClN2O3S2 — CID 110804822
(5-chlorothiophen-2-yl)-(4-propylsulfonylpiperazin-1-yl)methanone (PubChem CID 110804822) has the molecular formula C12H17ClN2O3S2 and a molecular weight of 336.87 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)-(4-propylsulfonylpiperazin-1-yl)methanone.
| Compound Name | (5-chlorothiophen-2-yl)-(4-propylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 110804822 |
| Molecular Formula | C12H17ClN2O3S2 |
| Molecular Weight | 336.87 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | (5-chlorothiophen-2-yl)-(4-propylsulfonylpiperazin-1-yl)methanone |
| SMILES | CCCS(=O)(=O)N1CCN(C(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C12H17ClN2O3S2/c1-2-9-20(17,18)15-7-5-14(6-8-15)12(16)10-3-4-11(13)19-10/h3-4H,2,5-9H2,1H3 |
| InChIKey | MFDLJHYSPFNROJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.87 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |