C24H32O5S — CID 11080544
(1R,4S,5R,8S,9R,12S,13R)-1,5-dimethyl-9-[3-(4-methylsulfanylphenyl)propyl]-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one (PubChem CID 11080544) has the molecular formula C24H32O5S and a molecular weight of 432.58 g/mol. Its IUPAC name is (1R,4S,5R,8S,9R,12S,13R)-1,5-dimethyl-9-[3-(4-methylsulfanylphenyl)propyl]-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one.
| Compound Name | (1R,4S,5R,8S,9R,12S,13R)-1,5-dimethyl-9-[3-(4-methylsulfanylphenyl)propyl]-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
|---|---|
| PubChem CID | 11080544 |
| Molecular Formula | C24H32O5S |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | (1R,4S,5R,8S,9R,12S,13R)-1,5-dimethyl-9-[3-(4-methylsulfanylphenyl)propyl]-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
| SMILES | CSc1ccc(CCC[C@H]2C(=O)O[C@@H]3O[C@@]4(C)CC[C@H]5[C@H](C)CC[C@@H]2[C@@]35OO4)cc1 |
| InChI | InChI=1S/C24H32O5S/c1-15-7-12-20-18(6-4-5-16-8-10-17(30-3)11-9-16)21(25)26-22-24(20)19(15)13-14-23(2,27-22)28-29-24/h8-11,15,18-20,22H,4-7,12-14H2,1-3H3/t15-,18-,19+,20+,22-,23-,24-/m1/s1 |
| InChIKey | CCFGMXMGPORTNC-BKAUZXKHSA-N |
| XLogP | 5.12 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|