About pyrazin-2-yl-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]methanone
pyrazin-2-yl-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]methanone (PubChem CID 110805442) has the molecular formula C15H20N6O3S
and a molecular weight of 364.43 g/mol. Its IUPAC name is pyrazin-2-yl-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]methanone.
Molecular Properties
| Compound Name | pyrazin-2-yl-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]methanone |
| PubChem CID | 110805442 |
| Molecular Formula | C15H20N6O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | pyrazin-2-yl-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]methanone |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)N1CCN(C(=O)c2cnccn2)CC1 |
| InChI | InChI=1S/C15H20N6O3S/c1-11-14(12(2)19(3)18-11)25(23,24)21-8-6-20(7-9-21)15(22)13-10-16-4-5-17-13/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | BEPYKZPOYICUBC-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 101.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze pyrazin-2-yl-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazin-2-yl-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]methanone?
The IUPAC name of pyrazin-2-yl-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]methanone (CID 110805442) is pyrazin-2-yl-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]methanone.
What is the SMILES notation for pyrazin-2-yl-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]methanone?
The canonical SMILES for pyrazin-2-yl-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]methanone is Cc1nn(C)c(C)c1S(=O)(=O)N1CCN(C(=O)c2cnccn2)CC1.
What is the InChIKey of pyrazin-2-yl-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]methanone?
The InChIKey is BEPYKZPOYICUBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N6O3S/c1-11-14(12(2)19(3)18-11)25(23,24)21-8-6-20(7-9-21)15(22)13-10-16-4-5-17-13/h4-5,10H,6-9H2,1-3H3.
What are the key properties of pyrazin-2-yl-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]methanone?
pyrazin-2-yl-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]methanone has a molecular weight of 364.43 g/mol, XLogP of -0.03, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazin-2-yl-[4-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]methanone is sourced from PubChem (CID 110805442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).