C16H20Cl2N2O3 — CID 110805791
1-[4-(2,5-dichloro-4-methoxybenzoyl)-1,4-diazepan-1-yl]propan-1-one (PubChem CID 110805791) has the molecular formula C16H20Cl2N2O3 and a molecular weight of 359.25 g/mol. Its IUPAC name is 1-[4-(2,5-dichloro-4-methoxybenzoyl)-1,4-diazepan-1-yl]propan-1-one.
| Compound Name | 1-[4-(2,5-dichloro-4-methoxybenzoyl)-1,4-diazepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 110805791 |
| Molecular Formula | C16H20Cl2N2O3 |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 1-[4-(2,5-dichloro-4-methoxybenzoyl)-1,4-diazepan-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCCN(C(=O)c2cc(Cl)c(OC)cc2Cl)CC1 |
| InChI | InChI=1S/C16H20Cl2N2O3/c1-3-15(21)19-5-4-6-20(8-7-19)16(22)11-9-13(18)14(23-2)10-12(11)17/h9-10H,3-8H2,1-2H3 |
| InChIKey | ISQPIOMRKKXBAZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |