C26H34O4Si — CID 11080651
(4aS,6R,9aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4,4a,8,9,9a-hexahydro-2H-pyrano[3,2-b]oxepin-7-one (PubChem CID 11080651) has the molecular formula C26H34O4Si and a molecular weight of 438.64 g/mol. Its IUPAC name is (4aS,6R,9aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4,4a,8,9,9a-hexahydro-2H-pyrano[3,2-b]oxepin-7-one.
| Compound Name | (4aS,6R,9aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4,4a,8,9,9a-hexahydro-2H-pyrano[3,2-b]oxepin-7-one |
|---|---|
| PubChem CID | 11080651 |
| Molecular Formula | C26H34O4Si |
| Molecular Weight | 438.64 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | (4aS,6R,9aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4,4a,8,9,9a-hexahydro-2H-pyrano[3,2-b]oxepin-7-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@H]2CCCO[C@@H]2CCC1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H34O4Si/c1-26(2,3)31(20-11-6-4-7-12-20,21-13-8-5-9-14-21)29-19-25-22(27)16-17-23-24(30-25)15-10-18-28-23/h4-9,11-14,23-25H,10,15-19H2,1-3H3/t23-,24+,25-/m1/s1 |
| InChIKey | ZYRWFKDRXBBQCY-DSNGMDLFSA-N |
| XLogP | 3.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.64 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|