C23H44O4Si2 — CID 11080703
ethyl (2E)-2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexylidene]acetate (PubChem CID 11080703) has the molecular formula C23H44O4Si2 and a molecular weight of 440.77 g/mol. Its IUPAC name is ethyl (2E)-2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexylidene]acetate.
| Compound Name | ethyl (2E)-2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexylidene]acetate |
|---|---|
| PubChem CID | 11080703 |
| Molecular Formula | C23H44O4Si2 |
| Molecular Weight | 440.77 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | ethyl (2E)-2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexylidene]acetate |
| SMILES | C=C1/C(=C/C(=O)OCC)C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O4Si2/c1-13-25-21(24)15-18-14-19(26-28(9,10)22(3,4)5)16-20(17(18)2)27-29(11,12)23(6,7)8/h15,19-20H,2,13-14,16H2,1,3-12H3/b18-15+/t19-,20+/m1/s1 |
| InChIKey | XMDYHFWALNDKPW-QCKBSDDKSA-N |
| XLogP | 6.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.77 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|