C20H21N3O2S — CID 110807857
2-(1H-indol-3-yl)-1-[4-(thiophene-2-carbonyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 110807857) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-1-[4-(thiophene-2-carbonyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2-(1H-indol-3-yl)-1-[4-(thiophene-2-carbonyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 110807857 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2-(1H-indol-3-yl)-1-[4-(thiophene-2-carbonyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | O=C(Cc1c[nH]c2ccccc12)N1CCCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C20H21N3O2S/c24-19(13-15-14-21-17-6-2-1-5-16(15)17)22-8-4-9-23(11-10-22)20(25)18-7-3-12-26-18/h1-3,5-7,12,14,21H,4,8-11,13H2 |
| InChIKey | BKMGDYHKABRNJP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |