C21H24N2O4 — CID 110808860
methyl 4-[2-(4-phenoxyphenyl)acetyl]-1,4-diazepane-1-carboxylate (PubChem CID 110808860) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is methyl 4-[2-(4-phenoxyphenyl)acetyl]-1,4-diazepane-1-carboxylate.
| Compound Name | methyl 4-[2-(4-phenoxyphenyl)acetyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 110808860 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | methyl 4-[2-(4-phenoxyphenyl)acetyl]-1,4-diazepane-1-carboxylate |
| SMILES | COC(=O)N1CCCN(C(=O)Cc2ccc(Oc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C21H24N2O4/c1-26-21(25)23-13-5-12-22(14-15-23)20(24)16-17-8-10-19(11-9-17)27-18-6-3-2-4-7-18/h2-4,6-11H,5,12-16H2,1H3 |
| InChIKey | QYLFRVSSFFMMME-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |