C18H24N2O12 — CID 11081029
[(2R,3S,4R,5R,6S)-2,3,4,5-tetraacetyloxy-6-cyano-7-nitroheptyl] acetate (PubChem CID 11081029) has the molecular formula C18H24N2O12 and a molecular weight of 460.39 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-2,3,4,5-tetraacetyloxy-6-cyano-7-nitroheptyl] acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-2,3,4,5-tetraacetyloxy-6-cyano-7-nitroheptyl] acetate |
|---|---|
| PubChem CID | 11081029 |
| Molecular Formula | C18H24N2O12 |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-2,3,4,5-tetraacetyloxy-6-cyano-7-nitroheptyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H](C#N)C[N+](=O)[O-] |
| InChI | InChI=1S/C18H24N2O12/c1-9(21)28-8-15(29-10(2)22)17(31-12(4)24)18(32-13(5)25)16(30-11(3)23)14(6-19)7-20(26)27/h14-18H,7-8H2,1-5H3/t14-,15-,16-,17+,18-/m1/s1 |
| InChIKey | LSMODWMSRRNVFD-HSFUPAIVSA-N |
| XLogP | -0.31 |
| TPSA | 198.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|