C17H25N3O2 — CID 110810660
N-benzyl-4-(2,2-dimethylpropanoyl)piperazine-1-carboxamide (PubChem CID 110810660) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is N-benzyl-4-(2,2-dimethylpropanoyl)piperazine-1-carboxamide.
| Compound Name | N-benzyl-4-(2,2-dimethylpropanoyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 110810660 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N-benzyl-4-(2,2-dimethylpropanoyl)piperazine-1-carboxamide |
| SMILES | CC(C)(C)C(=O)N1CCN(C(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C17H25N3O2/c1-17(2,3)15(21)19-9-11-20(12-10-19)16(22)18-13-14-7-5-4-6-8-14/h4-8H,9-13H2,1-3H3,(H,18,22) |
| InChIKey | IUKVYJYCKWGXGY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |