C15H8F13NO — CID 11081098
3-phenyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-4,5-dihydro-1,2-oxazole (PubChem CID 11081098) has the molecular formula C15H8F13NO and a molecular weight of 465.21 g/mol. Its IUPAC name is 3-phenyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-4,5-dihydro-1,2-oxazole.
| Compound Name | 3-phenyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 11081098 |
| Molecular Formula | C15H8F13NO |
| Molecular Weight | 465.21 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | 3-phenyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-4,5-dihydro-1,2-oxazole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C15H8F13NO/c16-10(17,9-6-8(29-30-9)7-4-2-1-3-5-7)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)28/h1-5,9H,6H2 |
| InChIKey | YRGWBIZBVALVSQ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.21 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|