About ethyl 4-[[4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carbonyl]amino]benzoate
ethyl 4-[[4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carbonyl]amino]benzoate (PubChem CID 11081103) has the molecular formula C24H27N5O5
and a molecular weight of 465.51 g/mol. Its IUPAC name is ethyl 4-[[4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carbonyl]amino]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[[4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carbonyl]amino]benzoate |
| PubChem CID | 11081103 |
| Molecular Formula | C24H27N5O5 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | ethyl 4-[[4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)N2CCN(c3ncnc4cc(OC)c(OC)cc34)CC2)cc1 |
| InChI | InChI=1S/C24H27N5O5/c1-4-34-23(30)16-5-7-17(8-6-16)27-24(31)29-11-9-28(10-12-29)22-18-13-20(32-2)21(33-3)14-19(18)25-15-26-22/h5-8,13-15H,4,9-12H2,1-3H3,(H,27,31) |
| InChIKey | SBRLCMBVANZVEY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethyl 4-[[4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carbonyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[[4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carbonyl]amino]benzoate?
The IUPAC name of ethyl 4-[[4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carbonyl]amino]benzoate (CID 11081103) is ethyl 4-[[4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carbonyl]amino]benzoate.
What is the SMILES notation for ethyl 4-[[4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carbonyl]amino]benzoate?
The canonical SMILES for ethyl 4-[[4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carbonyl]amino]benzoate is CCOC(=O)c1ccc(NC(=O)N2CCN(c3ncnc4cc(OC)c(OC)cc34)CC2)cc1.
What is the InChIKey of ethyl 4-[[4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carbonyl]amino]benzoate?
The InChIKey is SBRLCMBVANZVEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27N5O5/c1-4-34-23(30)16-5-7-17(8-6-16)27-24(31)29-11-9-28(10-12-29)22-18-13-20(32-2)21(33-3)14-19(18)25-15-26-22/h5-8,13-15H,4,9-12H2,1-3H3,(H,27,31).
What are the key properties of ethyl 4-[[4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carbonyl]amino]benzoate?
ethyl 4-[[4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carbonyl]amino]benzoate has a molecular weight of 465.51 g/mol, XLogP of 3.18, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[[4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carbonyl]amino]benzoate is sourced from PubChem (CID 11081103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).