C30H32NO2P — CID 11081169
(S)-[(1R,3S,3aR,6R)-2-tert-butyl-1-oxo-1,3-diphenyl-3a,6-dihydro-3H-2,1λ5-benzazaphosphol-6-yl]-phenylmethanol (PubChem CID 11081169) has the molecular formula C30H32NO2P and a molecular weight of 469.57 g/mol. Its IUPAC name is (S)-[(1R,3S,3aR,6R)-2-tert-butyl-1-oxo-1,3-diphenyl-3a,6-dihydro-3H-2,1λ5-benzazaphosphol-6-yl]-phenylmethanol.
| Compound Name | (S)-[(1R,3S,3aR,6R)-2-tert-butyl-1-oxo-1,3-diphenyl-3a,6-dihydro-3H-2,1λ5-benzazaphosphol-6-yl]-phenylmethanol |
|---|---|
| PubChem CID | 11081169 |
| Molecular Formula | C30H32NO2P |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | (S)-[(1R,3S,3aR,6R)-2-tert-butyl-1-oxo-1,3-diphenyl-3a,6-dihydro-3H-2,1λ5-benzazaphosphol-6-yl]-phenylmethanol |
| SMILES | CC(C)(C)N1[C@H](c2ccccc2)[C@H]2C=C[C@@H]([C@H](O)c3ccccc3)C=C2[P@]1(=O)c1ccccc1 |
| InChI | InChI=1S/C30H32NO2P/c1-30(2,3)31-28(22-13-7-4-8-14-22)26-20-19-24(29(32)23-15-9-5-10-16-23)21-27(26)34(31,33)25-17-11-6-12-18-25/h4-21,24,26,28-29,32H,1-3H3/t24-,26+,28-,29-,34-/m1/s1 |
| InChIKey | QVSXFBWSULMFTB-IOJMWGBASA-N |
| XLogP | 6.87 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|