C18H26FN3O3 — CID 110811893
N-tert-butyl-4-[2-(2-fluorophenoxy)acetyl]-1,4-diazepane-1-carboxamide (PubChem CID 110811893) has the molecular formula C18H26FN3O3 and a molecular weight of 351.42 g/mol. Its IUPAC name is N-tert-butyl-4-[2-(2-fluorophenoxy)acetyl]-1,4-diazepane-1-carboxamide.
| Compound Name | N-tert-butyl-4-[2-(2-fluorophenoxy)acetyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 110811893 |
| Molecular Formula | C18H26FN3O3 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | N-tert-butyl-4-[2-(2-fluorophenoxy)acetyl]-1,4-diazepane-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CCCN(C(=O)COc2ccccc2F)CC1 |
| InChI | InChI=1S/C18H26FN3O3/c1-18(2,3)20-17(24)22-10-6-9-21(11-12-22)16(23)13-25-15-8-5-4-7-14(15)19/h4-5,7-8H,6,9-13H2,1-3H3,(H,20,24) |
| InChIKey | DYEIMUFOZLDXBQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |