C12H26N4O3S — CID 110811938
N-tert-butyl-4-(dimethylsulfamoyl)-1,4-diazepane-1-carboxamide (PubChem CID 110811938) has the molecular formula C12H26N4O3S and a molecular weight of 306.43 g/mol. Its IUPAC name is N-tert-butyl-4-(dimethylsulfamoyl)-1,4-diazepane-1-carboxamide.
| Compound Name | N-tert-butyl-4-(dimethylsulfamoyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 110811938 |
| Molecular Formula | C12H26N4O3S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | N-tert-butyl-4-(dimethylsulfamoyl)-1,4-diazepane-1-carboxamide |
| SMILES | CN(C)S(=O)(=O)N1CCCN(C(=O)NC(C)(C)C)CC1 |
| InChI | InChI=1S/C12H26N4O3S/c1-12(2,3)13-11(17)15-7-6-8-16(10-9-15)20(18,19)14(4)5/h6-10H2,1-5H3,(H,13,17) |
| InChIKey | ZHXDLSVMOYBJDR-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |