C28H46O6 — CID 11081318
[(2E,6E,10R)-10-hydroxy-3,7-dimethyl-8-oxo-10-[(4R,5S)-2,2,4-trimethyl-5-(3-methylbut-2-enyl)-1,3-dioxolan-4-yl]deca-2,6-dienyl] 2,2-dimethylpropanoate (PubChem CID 11081318) has the molecular formula C28H46O6 and a molecular weight of 478.67 g/mol. Its IUPAC name is [(2E,6E,10R)-10-hydroxy-3,7-dimethyl-8-oxo-10-[(4R,5S)-2,2,4-trimethyl-5-(3-methylbut-2-enyl)-1,3-dioxolan-4-yl]deca-2,6-dienyl] 2,2-dimethylpropanoate.
| Compound Name | [(2E,6E,10R)-10-hydroxy-3,7-dimethyl-8-oxo-10-[(4R,5S)-2,2,4-trimethyl-5-(3-methylbut-2-enyl)-1,3-dioxolan-4-yl]deca-2,6-dienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11081318 |
| Molecular Formula | C28H46O6 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | [(2E,6E,10R)-10-hydroxy-3,7-dimethyl-8-oxo-10-[(4R,5S)-2,2,4-trimethyl-5-(3-methylbut-2-enyl)-1,3-dioxolan-4-yl]deca-2,6-dienyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)=CC[C@@H]1OC(C)(C)O[C@]1(C)[C@H](O)CC(=O)/C(C)=C/CC/C(C)=C/COC(=O)C(C)(C)C |
| InChI | InChI=1S/C28H46O6/c1-19(2)14-15-24-28(10,34-27(8,9)33-24)23(30)18-22(29)21(4)13-11-12-20(3)16-17-32-25(31)26(5,6)7/h13-14,16,23-24,30H,11-12,15,17-18H2,1-10H3/b20-16+,21-13+/t23-,24+,28-/m1/s1 |
| InChIKey | SHQQKQCRINSBBT-BNTREPSVSA-N |
| XLogP | 5.84 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|