About 3-imino-6,7-bis[3-(trifluoromethyl)phenyl]benzo[f]isoindol-1-amine
3-imino-6,7-bis[3-(trifluoromethyl)phenyl]benzo[f]isoindol-1-amine (PubChem CID 11081383) has the molecular formula C26H15F6N3
and a molecular weight of 483.42 g/mol. Its IUPAC name is 3-imino-6,7-bis[3-(trifluoromethyl)phenyl]benzo[f]isoindol-1-amine.
Molecular Properties
| Compound Name | 3-imino-6,7-bis[3-(trifluoromethyl)phenyl]benzo[f]isoindol-1-amine |
| PubChem CID | 11081383 |
| Molecular Formula | C26H15F6N3 |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 3-imino-6,7-bis[3-(trifluoromethyl)phenyl]benzo[f]isoindol-1-amine |
| SMILES | [H]/N=C1\N=C(N)c2cc3cc(-c4cccc(C(F)(F)F)c4)c(-c4cccc(C(F)(F)F)c4)cc3cc21 |
| InChI | InChI=1S/C26H15F6N3/c27-25(28,29)17-5-1-3-13(7-17)19-9-15-11-21-22(24(34)35-23(21)33)12-16(15)10-20(19)14-4-2-6-18(8-14)26(30,31)32/h1-12H,(H3,33,34,35) |
| InChIKey | YTABVERJHPHBMV-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-imino-6,7-bis[3-(trifluoromethyl)phenyl]benzo[f]isoindol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imino-6,7-bis[3-(trifluoromethyl)phenyl]benzo[f]isoindol-1-amine?
The IUPAC name of 3-imino-6,7-bis[3-(trifluoromethyl)phenyl]benzo[f]isoindol-1-amine (CID 11081383) is 3-imino-6,7-bis[3-(trifluoromethyl)phenyl]benzo[f]isoindol-1-amine.
What is the SMILES notation for 3-imino-6,7-bis[3-(trifluoromethyl)phenyl]benzo[f]isoindol-1-amine?
The canonical SMILES for 3-imino-6,7-bis[3-(trifluoromethyl)phenyl]benzo[f]isoindol-1-amine is [H]/N=C1\N=C(N)c2cc3cc(-c4cccc(C(F)(F)F)c4)c(-c4cccc(C(F)(F)F)c4)cc3cc21.
What is the InChIKey of 3-imino-6,7-bis[3-(trifluoromethyl)phenyl]benzo[f]isoindol-1-amine?
The InChIKey is YTABVERJHPHBMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H15F6N3/c27-25(28,29)17-5-1-3-13(7-17)19-9-15-11-21-22(24(34)35-23(21)33)12-16(15)10-20(19)14-4-2-6-18(8-14)26(30,31)32/h1-12H,(H3,33,34,35).
What are the key properties of 3-imino-6,7-bis[3-(trifluoromethyl)phenyl]benzo[f]isoindol-1-amine?
3-imino-6,7-bis[3-(trifluoromethyl)phenyl]benzo[f]isoindol-1-amine has a molecular weight of 483.42 g/mol, XLogP of 7.26, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imino-6,7-bis[3-(trifluoromethyl)phenyl]benzo[f]isoindol-1-amine is sourced from PubChem (CID 11081383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).