C31H39NO2Si — CID 11081420
(4S,5R)-5-[(1S)-1-(dibenzylamino)-3-methylbutyl]-4-[dimethyl(phenyl)silyl]oxolan-2-one (PubChem CID 11081420) has the molecular formula C31H39NO2Si and a molecular weight of 485.74 g/mol. Its IUPAC name is (4S,5R)-5-[(1S)-1-(dibenzylamino)-3-methylbutyl]-4-[dimethyl(phenyl)silyl]oxolan-2-one.
| Compound Name | (4S,5R)-5-[(1S)-1-(dibenzylamino)-3-methylbutyl]-4-[dimethyl(phenyl)silyl]oxolan-2-one |
|---|---|
| PubChem CID | 11081420 |
| Molecular Formula | C31H39NO2Si |
| Molecular Weight | 485.74 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | (4S,5R)-5-[(1S)-1-(dibenzylamino)-3-methylbutyl]-4-[dimethyl(phenyl)silyl]oxolan-2-one |
| SMILES | CC(C)C[C@@H]([C@H]1OC(=O)C[C@@H]1[Si](C)(C)c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H39NO2Si/c1-24(2)20-28(31-29(21-30(33)34-31)35(3,4)27-18-12-7-13-19-27)32(22-25-14-8-5-9-15-25)23-26-16-10-6-11-17-26/h5-19,24,28-29,31H,20-23H2,1-4H3/t28-,29-,31+/m0/s1 |
| InChIKey | GNQHWZDBNGOCJJ-GSBZAIBZSA-N |
| XLogP | 6.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.74 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|