C30H31NO6 — CID 11081634
ethyl (4aR,7aR)-6-benzyl-7a-hydroxy-3,3-bis(4-methylphenyl)-5-oxo-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate (PubChem CID 11081634) has the molecular formula C30H31NO6 and a molecular weight of 501.58 g/mol. Its IUPAC name is ethyl (4aR,7aR)-6-benzyl-7a-hydroxy-3,3-bis(4-methylphenyl)-5-oxo-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate.
| Compound Name | ethyl (4aR,7aR)-6-benzyl-7a-hydroxy-3,3-bis(4-methylphenyl)-5-oxo-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate |
|---|---|
| PubChem CID | 11081634 |
| Molecular Formula | C30H31NO6 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | ethyl (4aR,7aR)-6-benzyl-7a-hydroxy-3,3-bis(4-methylphenyl)-5-oxo-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate |
| SMILES | CCOC(=O)[C@]12CC(c3ccc(C)cc3)(c3ccc(C)cc3)OO[C@@]1(O)CN(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C30H31NO6/c1-4-35-27(33)28-19-29(24-14-10-21(2)11-15-24,25-16-12-22(3)13-17-25)36-37-30(28,34)20-31(26(28)32)18-23-8-6-5-7-9-23/h5-17,34H,4,18-20H2,1-3H3/t28-,30+/m1/s1 |
| InChIKey | GIEFVYCNFQBJAR-DGPALRBDSA-N |
| XLogP | 4.18 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|