C36H31NO2 — CID 11081772
16-(2,5-ditert-butylphenyl)-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6(23),7,9,11,13,18(22),19-decaene-15,17-dione (PubChem CID 11081772) has the molecular formula C36H31NO2 and a molecular weight of 509.65 g/mol. Its IUPAC name is 16-(2,5-ditert-butylphenyl)-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6(23),7,9,11,13,18(22),19-decaene-15,17-dione.
| Compound Name | 16-(2,5-ditert-butylphenyl)-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6(23),7,9,11,13,18(22),19-decaene-15,17-dione |
|---|---|
| PubChem CID | 11081772 |
| Molecular Formula | C36H31NO2 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | 16-(2,5-ditert-butylphenyl)-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6(23),7,9,11,13,18(22),19-decaene-15,17-dione |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c(N2C(=O)c3ccc4c5cccc6cccc(c7ccc(c3c47)C2=O)c65)c1 |
| InChI | InChI=1S/C36H31NO2/c1-35(2,3)21-13-18-28(36(4,5)6)29(19-21)37-33(38)26-16-14-24-22-11-7-9-20-10-8-12-23(30(20)22)25-15-17-27(34(37)39)32(26)31(24)25/h7-19H,1-6H3 |
| InChIKey | WPVHXFPEBJZDPS-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|