C27H34N2O6Si — CID 11081790
(2R,3S,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2,4-dimethoxypyrimidin-5-yl)oxolane-3,4-diol (PubChem CID 11081790) has the molecular formula C27H34N2O6Si and a molecular weight of 510.66 g/mol. Its IUPAC name is (2R,3S,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2,4-dimethoxypyrimidin-5-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2,4-dimethoxypyrimidin-5-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 11081790 |
| Molecular Formula | C27H34N2O6Si |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | (2R,3S,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(2,4-dimethoxypyrimidin-5-yl)oxolane-3,4-diol |
| SMILES | COc1ncc([C@@H]2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H](O)[C@H]2O)c(OC)n1 |
| InChI | InChI=1S/C27H34N2O6Si/c1-27(2,3)36(18-12-8-6-9-13-18,19-14-10-7-11-15-19)34-17-21-22(30)23(31)24(35-21)20-16-28-26(33-5)29-25(20)32-4/h6-16,21-24,30-31H,17H2,1-5H3/t21-,22-,23-,24+/m1/s1 |
| InChIKey | QRWIHHLPHPAMGG-YCAMKHIRSA-N |
| XLogP | 2.23 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|