About [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium tetrafluoroborate
[1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium tetrafluoroborate (PubChem CID 11081911) has the molecular formula C26H29BF4NO3P
and a molecular weight of 521.30 g/mol. Its IUPAC name is [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium tetrafluoroborate.
Molecular Properties
| Compound Name | [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium tetrafluoroborate |
| PubChem CID | 11081911 |
| Molecular Formula | C26H29BF4NO3P |
| Molecular Weight | 521.30 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium tetrafluoroborate |
| SMILES | COC(=O)C(NC(=O)C(C)(C)C)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C26H28NO3P.BF4/c1-26(2,3)25(29)27-23(24(28)30-4)31(20-14-8-5-9-15-20,21-16-10-6-11-17-21)22-18-12-7-13-19-22;2-1(3,4)5/h5-19,23H,1-4H3;/q;-1/p+1 |
| InChIKey | VTPSPHZGSJCNNV-UHFFFAOYSA-O |
| XLogP | 4.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 521.30 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium tetrafluoroborate?
The IUPAC name of [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium tetrafluoroborate (CID 11081911) is [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium tetrafluoroborate.
What is the SMILES notation for [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium tetrafluoroborate?
The canonical SMILES for [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium tetrafluoroborate is COC(=O)C(NC(=O)C(C)(C)C)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.F[B-](F)(F)F.
What is the InChIKey of [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium tetrafluoroborate?
The InChIKey is VTPSPHZGSJCNNV-UHFFFAOYSA-O. The full InChI is InChI=1S/C26H28NO3P.BF4/c1-26(2,3)25(29)27-23(24(28)30-4)31(20-14-8-5-9-15-20,21-16-10-6-11-17-21)22-18-12-7-13-19-22;2-1(3,4)5/h5-19,23H,1-4H3;/q;-1/p+1.
What are the key properties of [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium tetrafluoroborate?
[1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium tetrafluoroborate has a molecular weight of 521.30 g/mol, XLogP of 4.94, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,2-dimethylpropanoylamino)-2-methoxy-2-oxoethyl]-triphenylphosphanium tetrafluoroborate is sourced from PubChem (CID 11081911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).