C30H34ClNO5 — CID 11081938
[2-chloro-4-formyl-5-methoxy-3-methyl-6-[(2E,4E)-3-methyl-5-[(1R,2R,6R)-1,2,6-trimethyl-3-oxocyclohexyl]penta-2,4-dienyl]phenyl] pyridine-3-carboxylate (PubChem CID 11081938) has the molecular formula C30H34ClNO5 and a molecular weight of 524.06 g/mol. Its IUPAC name is [2-chloro-4-formyl-5-methoxy-3-methyl-6-[(2E,4E)-3-methyl-5-[(1R,2R,6R)-1,2,6-trimethyl-3-oxocyclohexyl]penta-2,4-dienyl]phenyl] pyridine-3-carboxylate.
| Compound Name | [2-chloro-4-formyl-5-methoxy-3-methyl-6-[(2E,4E)-3-methyl-5-[(1R,2R,6R)-1,2,6-trimethyl-3-oxocyclohexyl]penta-2,4-dienyl]phenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 11081938 |
| Molecular Formula | C30H34ClNO5 |
| Molecular Weight | 524.06 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | [2-chloro-4-formyl-5-methoxy-3-methyl-6-[(2E,4E)-3-methyl-5-[(1R,2R,6R)-1,2,6-trimethyl-3-oxocyclohexyl]penta-2,4-dienyl]phenyl] pyridine-3-carboxylate |
| SMILES | COc1c(C=O)c(C)c(Cl)c(OC(=O)c2cccnc2)c1C/C=C(C)/C=C/[C@@]1(C)[C@H](C)CCC(=O)[C@@H]1C |
| InChI | InChI=1S/C30H34ClNO5/c1-18(13-14-30(5)19(2)10-12-25(34)21(30)4)9-11-23-27(36-6)24(17-33)20(3)26(31)28(23)37-29(35)22-8-7-15-32-16-22/h7-9,13-17,19,21H,10-12H2,1-6H3/b14-13+,18-9+/t19-,21+,30+/m1/s1 |
| InChIKey | QYYQMVBCSFNUSE-BVSZBTBXSA-N |
| XLogP | 6.77 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.06 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|