C18H24N2O3 — CID 110819733
3-methyl-N-[1-(oxolane-2-carbonyl)piperidin-4-yl]benzamide (PubChem CID 110819733) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-methyl-N-[1-(oxolane-2-carbonyl)piperidin-4-yl]benzamide.
| Compound Name | 3-methyl-N-[1-(oxolane-2-carbonyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 110819733 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 3-methyl-N-[1-(oxolane-2-carbonyl)piperidin-4-yl]benzamide |
| SMILES | Cc1cccc(C(=O)NC2CCN(C(=O)C3CCCO3)CC2)c1 |
| InChI | InChI=1S/C18H24N2O3/c1-13-4-2-5-14(12-13)17(21)19-15-7-9-20(10-8-15)18(22)16-6-3-11-23-16/h2,4-5,12,15-16H,3,6-11H2,1H3,(H,19,21) |
| InChIKey | ZWJBFUMZFLDOCB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |