C31H55NO4Si — CID 11082043
tert-butyl (4R)-4-[(1Z,5E,7E,11R)-11-[tert-butyl(dimethyl)silyl]oxy-8-methyltetradeca-1,5,7,13-tetraenyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 11082043) has the molecular formula C31H55NO4Si and a molecular weight of 533.87 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(1Z,5E,7E,11R)-11-[tert-butyl(dimethyl)silyl]oxy-8-methyltetradeca-1,5,7,13-tetraenyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(1Z,5E,7E,11R)-11-[tert-butyl(dimethyl)silyl]oxy-8-methyltetradeca-1,5,7,13-tetraenyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11082043 |
| Molecular Formula | C31H55NO4Si |
| Molecular Weight | 533.87 g/mol |
| Exact Mass | 533.39 |
| IUPAC Name | tert-butyl (4R)-4-[(1Z,5E,7E,11R)-11-[tert-butyl(dimethyl)silyl]oxy-8-methyltetradeca-1,5,7,13-tetraenyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CC[C@@H](CC/C(C)=C/C=C/CC/C=C\[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H55NO4Si/c1-13-19-27(36-37(11,12)30(6,7)8)23-22-25(2)20-17-15-14-16-18-21-26-24-34-31(9,10)32(26)28(33)35-29(3,4)5/h13,15,17-18,20-21,26-27H,1,14,16,19,22-24H2,2-12H3/b17-15+,21-18-,25-20+/t26-,27+/m1/s1 |
| InChIKey | KTKWTWZGIVTOCS-OAYJGPQKSA-N |
| XLogP | 8.94 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.87 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|