C15H16N4O2S — CID 110821257
N-[1-(pyrazine-2-carbonyl)piperidin-4-yl]thiophene-2-carboxamide (PubChem CID 110821257) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is N-[1-(pyrazine-2-carbonyl)piperidin-4-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-(pyrazine-2-carbonyl)piperidin-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 110821257 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-[1-(pyrazine-2-carbonyl)piperidin-4-yl]thiophene-2-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)c2cnccn2)CC1)c1cccs1 |
| InChI | InChI=1S/C15H16N4O2S/c20-14(13-2-1-9-22-13)18-11-3-7-19(8-4-11)15(21)12-10-16-5-6-17-12/h1-2,5-6,9-11H,3-4,7-8H2,(H,18,20) |
| InChIKey | KFJRHYIPKUPQCA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |