C16H24N2O2S — CID 110822238
N-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]thiophene-2-carboxamide (PubChem CID 110822238) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is N-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 110822238 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | N-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]thiophene-2-carboxamide |
| SMILES | CC(C)(C)CC(=O)N1CCC(NC(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C16H24N2O2S/c1-16(2,3)11-14(19)18-8-6-12(7-9-18)17-15(20)13-5-4-10-21-13/h4-5,10,12H,6-9,11H2,1-3H3,(H,17,20) |
| InChIKey | GNPXIMKAPDEMLE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |