C31H66O6Si2 — CID 11082518
[(3R,4R,5R,6R,9S)-5-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-9-methoxy-4,6-dimethyl-3-triethylsilyloxyundecyl] 2,2-dimethylpropanoate (PubChem CID 11082518) has the molecular formula C31H66O6Si2 and a molecular weight of 591.04 g/mol. Its IUPAC name is [(3R,4R,5R,6R,9S)-5-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-9-methoxy-4,6-dimethyl-3-triethylsilyloxyundecyl] 2,2-dimethylpropanoate.
| Compound Name | [(3R,4R,5R,6R,9S)-5-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-9-methoxy-4,6-dimethyl-3-triethylsilyloxyundecyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11082518 |
| Molecular Formula | C31H66O6Si2 |
| Molecular Weight | 591.04 g/mol |
| Exact Mass | 590.44 |
| IUPAC Name | [(3R,4R,5R,6R,9S)-5-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-9-methoxy-4,6-dimethyl-3-triethylsilyloxyundecyl] 2,2-dimethylpropanoate |
| SMILES | CC[Si](CC)(CC)O[C@H](CCOC(=O)C(C)(C)C)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CC[C@H](OC)C(C)O |
| InChI | InChI=1S/C31H66O6Si2/c1-16-39(17-2,18-3)36-26(21-22-35-29(33)30(7,8)9)24(5)28(37-38(14,15)31(10,11)12)23(4)19-20-27(34-13)25(6)32/h23-28,32H,16-22H2,1-15H3/t23-,24-,25?,26-,27+,28-/m1/s1 |
| InChIKey | NPFBZXXVGOYSCB-WDWAIWMASA-N |
| XLogP | 8.19 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.04 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|