About 1-N,5-N-bis(furan-2-ylmethyl)naphthalene-1,5-disulfonamide
1-N,5-N-bis(furan-2-ylmethyl)naphthalene-1,5-disulfonamide (PubChem CID 1108254) has the molecular formula C20H18N2O6S2
and a molecular weight of 446.51 g/mol. Its IUPAC name is 1-N,5-N-bis(furan-2-ylmethyl)naphthalene-1,5-disulfonamide.
Molecular Properties
| Compound Name | 1-N,5-N-bis(furan-2-ylmethyl)naphthalene-1,5-disulfonamide |
| PubChem CID | 1108254 |
| Molecular Formula | C20H18N2O6S2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 1-N,5-N-bis(furan-2-ylmethyl)naphthalene-1,5-disulfonamide |
| SMILES | O=S(=O)(NCc1ccco1)c1cccc2c(S(=O)(=O)NCc3ccco3)cccc12 |
| InChI | InChI=1S/C20H18N2O6S2/c23-29(24,21-13-15-5-3-11-27-15)19-9-1-7-17-18(19)8-2-10-20(17)30(25,26)22-14-16-6-4-12-28-16/h1-12,21-22H,13-14H2 |
| InChIKey | YJIHIMAJNMNWIG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-N,5-N-bis(furan-2-ylmethyl)naphthalene-1,5-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,5-N-bis(furan-2-ylmethyl)naphthalene-1,5-disulfonamide?
The IUPAC name of 1-N,5-N-bis(furan-2-ylmethyl)naphthalene-1,5-disulfonamide (CID 1108254) is 1-N,5-N-bis(furan-2-ylmethyl)naphthalene-1,5-disulfonamide.
What is the SMILES notation for 1-N,5-N-bis(furan-2-ylmethyl)naphthalene-1,5-disulfonamide?
The canonical SMILES for 1-N,5-N-bis(furan-2-ylmethyl)naphthalene-1,5-disulfonamide is O=S(=O)(NCc1ccco1)c1cccc2c(S(=O)(=O)NCc3ccco3)cccc12.
What is the InChIKey of 1-N,5-N-bis(furan-2-ylmethyl)naphthalene-1,5-disulfonamide?
The InChIKey is YJIHIMAJNMNWIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O6S2/c23-29(24,21-13-15-5-3-11-27-15)19-9-1-7-17-18(19)8-2-10-20(17)30(25,26)22-14-16-6-4-12-28-16/h1-12,21-22H,13-14H2.
What are the key properties of 1-N,5-N-bis(furan-2-ylmethyl)naphthalene-1,5-disulfonamide?
1-N,5-N-bis(furan-2-ylmethyl)naphthalene-1,5-disulfonamide has a molecular weight of 446.51 g/mol, XLogP of 2.98, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,5-N-bis(furan-2-ylmethyl)naphthalene-1,5-disulfonamide is sourced from PubChem (CID 1108254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).