C20H22BrClN2O — CID 110825597
1-(4-bromophenyl)-2-[[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]amino]ethanone (PubChem CID 110825597) has the molecular formula C20H22BrClN2O and a molecular weight of 421.77 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-[[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]amino]ethanone.
| Compound Name | 1-(4-bromophenyl)-2-[[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]amino]ethanone |
|---|---|
| PubChem CID | 110825597 |
| Molecular Formula | C20H22BrClN2O |
| Molecular Weight | 421.77 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 1-(4-bromophenyl)-2-[[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]amino]ethanone |
| SMILES | O=C(CNCC(c1ccccc1Cl)N1CCCC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H22BrClN2O/c21-16-9-7-15(8-10-16)20(25)14-23-13-19(24-11-3-4-12-24)17-5-1-2-6-18(17)22/h1-2,5-10,19,23H,3-4,11-14H2 |
| InChIKey | OQDBRAGGBGPQLL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.77 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |